ChemNet > CAS > 881-07-2 8-Nitroquinaldine
881-07-2 8-Nitroquinaldine
Naam product |
8-Nitroquinaldine |
Synoniemen |
Nitroquinaldine; 2-Methyl-8-nitroquinoline |
MF |
C10H8N2O2 |
Molecuulgewicht |
188.1827 |
InChI |
InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
CAS-nummer |
881-07-2 |
EINECS |
212-919-6 |
Moleculaire Structuur |
|
Dichtheid |
1.298g/cm3 |
Kookpunt |
323.8°C at 760 mmHg |
Brekingsindex |
1.661 |
Vlampunt |
149.6°C |
Gevaarsymbolen |
|
Risico-codes |
R40:Possible risks of irreversible effects.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|