ChemNet > CAS > 90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
Naam product |
2-Hydroxy-4,6-dimethoxyacetophenone |
Synoniemen |
xanthoxylin |
MF |
C10H12O4 |
Molecuulgewicht |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
CAS-nummer |
90-24-4 |
EINECS |
201-978-3 |
Moleculaire Structuur |
|
Dichtheid |
1.172g/cm3 |
Smeltpunt |
80-82℃ |
Kookpunt |
355.1°C at 760 mmHg |
Brekingsindex |
1.527 |
Vlampunt |
141.2°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|