ChemNet > CAS > 91-48-5 alpha-Phenylcinnamic acid
91-48-5 alpha-Phenylcinnamic acid
Naam product |
alpha-Phenylcinnamic acid |
Synoniemen |
a-Phenyl-trans-cinnamic acid, Pract.; a-(Phenylmethylene)benzeneacetic acid, Pract.; Phenylcinnamicacid,98%; (2E)-2,3-diphenylprop-2-enoic acid; 2,3-diphenylprop-2-enoic acid; (2Z)-2,3-diphenylprop-2-enoic acid; (2E)-2,3-diphenylprop-2-enoate; (2Z)-2,3-diphenylprop-2-enoate |
MF |
C15H11O2 |
Molecuulgewicht |
223.2472 |
InChI |
InChI=1/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/p-1/b14-11- |
CAS-nummer |
91-48-5 |
EINECS |
202-069-4 |
Moleculaire Structuur |
|
Smeltpunt |
171-175℃ |
Kookpunt |
336.6°C at 760 mmHg |
Vlampunt |
239.8°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|