ChemNet > CAS > 93-53-8 2-Phenylpropionaldehyde
93-53-8 2-Phenylpropionaldehyde
Naam product |
2-Phenylpropionaldehyde |
Synoniemen |
2-Phenylpropanal; alpha-methylphenylacetaldehyde; hydratopic aldehyde; Hydratropic aldehyde |
MF |
C9H10O |
Molecuulgewicht |
134.1751 |
InChI |
InChI=1/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3 |
CAS-nummer |
93-53-8 |
EINECS |
202-255-5 |
Moleculaire Structuur |
|
Dichtheid |
0.98g/cm3 |
Kookpunt |
202.3°C at 760 mmHg |
Brekingsindex |
1.505 |
Vlampunt |
76.1°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|