ChemNet > CAS > 942-92-7 Hexanophenone
942-92-7 Hexanophenone
| Naam product |
Hexanophenone |
| Synoniemen |
n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
| MF |
C12H16O |
| Molecuulgewicht |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| CAS-nummer |
942-92-7 |
| EINECS |
213-394-6 |
| Moleculaire Structuur |
|
| Dichtheid |
0.942g/cm3 |
| Smeltpunt |
25-26℃ |
| Kookpunt |
265°C at 760 mmHg |
| Brekingsindex |
1.498 |
| Vlampunt |
105.5°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
