ChemNet > CAS > 942-92-7 Hexanophenone
942-92-7 Hexanophenone
Naam product |
Hexanophenone |
Synoniemen |
n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
MF |
C12H16O |
Molecuulgewicht |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
CAS-nummer |
942-92-7 |
EINECS |
213-394-6 |
Moleculaire Structuur |
|
Dichtheid |
0.942g/cm3 |
Smeltpunt |
25-26℃ |
Kookpunt |
265°C at 760 mmHg |
Brekingsindex |
1.498 |
Vlampunt |
105.5°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|