ChemNet > CAS > 945-49-3 cyclohexyl(phenyl)methanol
945-49-3 cyclohexyl(phenyl)methanol
Naam product |
cyclohexyl(phenyl)methanol |
Synoniemen |
Methanol, cyclohexylphenyl-; 3-06-00-02527 (Beilstein Handbook Reference); BRN 2048295; Cyclohexanemethanol, alpha-phenyl-; Cyclohexylphenylmethanol; NSC 28611; Benzenemethanol, alpha-cyclohexyl- (9CI) |
MF |
C13H18O |
Molecuulgewicht |
190.2814 |
InChI |
InChI=1/C13H18O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12-14H,2,5-6,9-10H2 |
CAS-nummer |
945-49-3 |
Moleculaire Structuur |
|
Dichtheid |
1.039g/cm3 |
Smeltpunt |
48℃ |
Kookpunt |
305.1°C at 760 mmHg |
Brekingsindex |
1.55 |
Vlampunt |
128.1°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|