ChemNet > CAS > 95453-54-6 2,4-dimethyl-1,3-thiazole-5-carbaldehyde
95453-54-6 2,4-dimethyl-1,3-thiazole-5-carbaldehyde
Naam product |
2,4-dimethyl-1,3-thiazole-5-carbaldehyde |
Synoniemen |
2,4-dimethylthiazole-5-carbaldehyde |
MF |
C6H7NOS |
Molecuulgewicht |
141.1909 |
InChI |
InChI=1/C6H7NOS/c1-4-6(3-8)9-5(2)7-4/h3H,1-2H3 |
CAS-nummer |
95453-54-6 |
Moleculaire Structuur |
|
Dichtheid |
1.213g/cm3 |
Kookpunt |
238.884°C at 760 mmHg |
Brekingsindex |
1.588 |
Vlampunt |
98.274°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|