ChemNet > CAS > 96-04-8 2,3-heptanedione
96-04-8 2,3-heptanedione
| Naam product |
2,3-heptanedione |
| Synoniemen |
2,3-Heptanedione; Acetyl pentanoyl; Acetyl valeryl; FEMA No. 2543; NSC 31668; UNII-DK55DDE86P; Valerylacetyl; heptane-2,3-dione |
| MF |
C7H12O2 |
| Molecuulgewicht |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
| CAS-nummer |
96-04-8 |
| EINECS |
202-472-5 |
| Moleculaire Structuur |
|
| Dichtheid |
0.926g/cm3 |
| Kookpunt |
149.7°C at 760 mmHg |
| Brekingsindex |
1.413 |
| Vlampunt |
45°C |
| Gevaarsymbolen |
|
| Risico-codes |
R10:Flammable.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
