ChemNet > CAS > 96784-54-2 3-Methyl-4-nitrobenzonitrile
96784-54-2 3-Methyl-4-nitrobenzonitrile
Naam product |
3-Methyl-4-nitrobenzonitrile |
Synoniemen |
4-Nitro-m-tolunitrile;
|
MF |
C8H6N2O2 |
Molecuulgewicht |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
CAS-nummer |
96784-54-2 |
Moleculaire Structuur |
|
Dichtheid |
1.26g/cm3 |
Smeltpunt |
82-83℃ |
Kookpunt |
322.2°C at 760 mmHg |
Brekingsindex |
1.568 |
Vlampunt |
148.6°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|