ChemNet > CAS > 973-67-1 5,6,7-Trimethoxyflavone
973-67-1 5,6,7-Trimethoxyflavone
Naam product |
5,6,7-Trimethoxyflavone |
Synoniemen |
Baicalein trimethyl ether; 5,6,7-trimethoxy-2-phenyl-4H-chromen-4-one |
MF |
C18H16O5 |
Molecuulgewicht |
312.3166 |
InChI |
InChI=1/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3 |
CAS-nummer |
973-67-1 |
Moleculaire Structuur |
|
Dichtheid |
1.242g/cm3 |
Smeltpunt |
165-167℃ |
Kookpunt |
497.4°C at 760 mmHg |
Brekingsindex |
1.585 |
Vlampunt |
221.3°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|