ChemNet > CAS > 98437-24-2 Benzo(b)furan-2-boronic acid
98437-24-2 Benzo(b)furan-2-boronic acid
Naam product |
Benzo(b)furan-2-boronic acid |
Synoniemen |
Benzofuran-2-boronic acid; Benzo[b]furan-2-boronic acid; 1-Benzofuran-2-ylboronic acid; Benzofuran-2-ylboronic acid |
MF |
C8H7BO3 |
Molecuulgewicht |
161.9504 |
InChI |
InChI=1/C8H7BO3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H |
CAS-nummer |
98437-24-2 |
Moleculaire Structuur |
|
Dichtheid |
1.31g/cm3 |
Smeltpunt |
114-116℃ |
Kookpunt |
340.4°C at 760 mmHg |
Brekingsindex |
1.618 |
Vlampunt |
159.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|