ChemNet > CAS > 998-29-8 Tri-n-propylsilane
998-29-8 Tri-n-propylsilane
Naam product |
Tri-n-propylsilane |
Synoniemen |
Silane, tripropyl-; NSC 96837; Tripropylsilane; tripropylsilyl |
MF |
C9H21Si |
Molecuulgewicht |
157.3485 |
InChI |
InChI=1/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
CAS-nummer |
998-29-8 |
EINECS |
213-649-1 |
Moleculaire Structuur |
|
Gevaarsymbolen |
|
Risico-codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|