ChemNet > CAS > 101-99-5 N-Phenylurethane
101-99-5 N-Phenylurethane
produktnavn |
N-Phenylurethane |
Synonymer |
Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
Molekylær Formel |
C9H11NO2 |
Molekylvekt |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
CAS-nummer |
101-99-5 |
EINECS |
202-995-9 |
Molecular Structure |
|
Tetthet |
1.136g/cm3 |
Kokepunkt |
238°C at 760 mmHg |
Brytningsindeks |
1.558 |
Flammepunktet |
79.2°C |
Hazard symboler |
|
Risiko Koder |
R40:Possible risks of irreversible effects.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|