ChemNet > CAS > 103-19-5 p-Tolyl disulfide
103-19-5 p-Tolyl disulfide
produktnavn |
p-Tolyl disulfide |
Molekylær Formel |
C14H14S2 |
Molekylvekt |
246.391 |
InChI |
InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
CAS-nummer |
103-19-5 |
EINECS |
203-087-5 |
Molecular Structure |
|
Tetthet |
1.17g/cm3 |
Smeltepunkt |
43-46℃ |
Kokepunkt |
349.5°C at 760 mmHg |
Brytningsindeks |
1.649 |
Flammepunktet |
192.6°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|