ChemNet > CAS > 10323-20-3;28697-53-2 D(-)-Arabinose
10323-20-3;28697-53-2 D(-)-Arabinose
produktnavn |
D(-)-Arabinose |
Synonymer |
Arabinose(D); D-(-)-Arabinose; D-arabinopyranose; beta-L-arabinopyranose; .beta.-D-Arabinopyranose; beta-D-arabinopyranose; alpha-D-arabinopyranose; D-Arabinose; pectinose; Pectin sugar; beta-D-(-)-Arabinose |
Molekylær Formel |
C5H10O5 |
Molekylvekt |
150.1299 |
InChI |
InChI=1/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5-/m0/s1 |
CAS-nummer |
10323-20-3;28697-53-2 |
EINECS |
233-708-5 |
Molecular Structure |
|
Tetthet |
1.757g/cm3 |
Smeltepunkt |
152-160℃ |
Kokepunkt |
333.2°C at 760 mmHg |
Brytningsindeks |
1.646 |
Flammepunktet |
155.3°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|