ChemNet > CAS > 1036-72-2 5,7-Dimethoxyflavanone
1036-72-2 5,7-Dimethoxyflavanone
produktnavn |
5,7-Dimethoxyflavanone |
Synonymer |
Pinocembrin dimethyl ether; 5,7-dimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
Molekylær Formel |
C17H16O4 |
Molekylvekt |
284.3065 |
InChI |
InChI=1/C17H16O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-9,14H,10H2,1-2H3 |
CAS-nummer |
1036-72-2 |
Molecular Structure |
|
Tetthet |
1.204g/cm3 |
Kokepunkt |
468.8°C at 760 mmHg |
Brytningsindeks |
1.574 |
Flammepunktet |
209.4°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|