ChemNet > CAS > 104-66-5 1,2-Diphenoxyethane
104-66-5 1,2-Diphenoxyethane
produktnavn |
1,2-Diphenoxyethane |
Synonymer |
Ethylene glycol diphenyl ether; 1,1'-[ethane-1,2-diylbis(oxy)]dibenzene; 1,2-Diphenoxy ethane |
Molekylær Formel |
C14H14O2 |
Molekylvekt |
214.2598 |
InChI |
InChI=1/C14H14O2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
CAS-nummer |
104-66-5 |
EINECS |
203-224-9 |
Molecular Structure |
|
Tetthet |
1.08g/cm3 |
Smeltepunkt |
95-98℃ |
Kokepunkt |
341.6°C at 760 mmHg |
Brytningsindeks |
1.556 |
Flammepunktet |
139.4°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|