ChemNet > CAS > 105-05-5 1,4-Diethylbenzene
105-05-5 1,4-Diethylbenzene
produktnavn |
1,4-Diethylbenzene |
Synonymer |
Benzene, 1,4-diethyl-; Benzene, p-diethyl-; HSDB 4083; p-Diethylbenzene; p-Ethylethylbenzene; butan-2-ylbenzene; PDEB |
Molekylær Formel |
C10H14 |
Molekylvekt |
134.2182 |
InChI |
InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
CAS-nummer |
105-05-5 |
EINECS |
203-265-2 |
Molecular Structure |
|
Tetthet |
0.86g/cm3 |
Smeltepunkt |
-43℃ |
Kokepunkt |
173.3°C at 760 mmHg |
Brytningsindeks |
1.489 |
Flammepunktet |
46.3°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|