ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
produktnavn |
2,6-Dibromo-4-nitrotoluene |
Synonymer |
1,3-dibromo-2-methyl-5-nitrobenzene |
Molekylær Formel |
C7H5Br2NO2 |
Molekylvekt |
294.9281 |
InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
CAS-nummer |
110127-07-6 |
Molecular Structure |
|
Tetthet |
1.967g/cm3 |
Kokepunkt |
320.4°C at 760 mmHg |
Brytningsindeks |
1.625 |
Flammepunktet |
147.6°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|