ChemNet > CAS > 110888-15-8 4-Chloro-3-fluorobenzonitrile
110888-15-8 4-Chloro-3-fluorobenzonitrile
| produktnavn |
4-Chloro-3-fluorobenzonitrile |
| Synonymer |
BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
| Molekylær Formel |
C7H3ClFN |
| Molekylvekt |
155.5568 |
| InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| CAS-nummer |
110888-15-8 |
| Molecular Structure |
|
| Tetthet |
1.33g/cm3 |
| Smeltepunkt |
79-81°C |
| Kokepunkt |
214°C at 760 mmHg |
| Brytningsindeks |
1.536 |
| Flammepunktet |
83.2°C |
| Hazard symboler |
 T,Xi:;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
