ChemNet > CAS > 112-61-8 Methyl stearate
112-61-8 Methyl stearate
produktnavn |
Methyl stearate |
Synonymer |
Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
Molekylær Formel |
C19H38O2 |
Molekylvekt |
298.5038 |
InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
CAS-nummer |
112-61-8 |
EINECS |
203-990-4 |
Molecular Structure |
|
Tetthet |
0.863g/cm3 |
Smeltepunkt |
37-39℃ |
Kokepunkt |
355.5°C at 760 mmHg |
Brytningsindeks |
1.444 |
Flammepunktet |
169.3°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|