ChemNet > CAS > 1146-65-2 Naphthalene-d8
1146-65-2 Naphthalene-d8
| produktnavn |
Naphthalene-d8 |
| Molekylær Formel |
C10D8 |
| Molekylvekt |
136.2198 |
| InChI |
InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| CAS-nummer |
1146-65-2 |
| EINECS |
214-552-7 |
| Molecular Structure |
|
| Tetthet |
1.102g/cm3 |
| Smeltepunkt |
81-83℃ |
| Kokepunkt |
221.5°C at 760 mmHg |
| Brytningsindeks |
1.632 |
| Flammepunktet |
78.9°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
