ChemNet > CAS > 117-12-4 1,5-dihydroxyanthraquinone
117-12-4 1,5-dihydroxyanthraquinone
produktnavn |
1,5-dihydroxyanthraquinone |
Synonymer |
Anthrarufin,80%; 9,10-Anthracenedione, 1,5-dihydroxy-; ANTHRARUFIN; 1,5-dihydroxyanthracene-9,10-dione |
Molekylær Formel |
C14H8O4 |
Molekylvekt |
240.2109 |
InChI |
InChI=1/C14H8O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15-16H |
CAS-nummer |
117-12-4 |
EINECS |
204-175-6 |
Molecular Structure |
|
Tetthet |
1.54g/cm3 |
Smeltepunkt |
268-273℃ |
Kokepunkt |
452.7°C at 760 mmHg |
Brytningsindeks |
1.732 |
Flammepunktet |
241.7°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|