ChemNet > CAS > 120355-50-2 2,6-Dichloro-beta-nitrostyrene
120355-50-2 2,6-Dichloro-beta-nitrostyrene
| produktnavn |
2,6-Dichloro-beta-nitrostyrene |
| Synonymer |
1-(2,6-Dichlorophenyl)-2-nitroethene; 1,3-dichloro-2-[(E)-2-nitroethenyl]benzene |
| Molekylær Formel |
C8H5Cl2NO2 |
| Molekylvekt |
218.0368 |
| InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+ |
| CAS-nummer |
120355-50-2 |
| Molecular Structure |
|
| Tetthet |
1.447g/cm3 |
| Kokepunkt |
330.6°C at 760 mmHg |
| Brytningsindeks |
1.626 |
| Flammepunktet |
153.7°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
