ChemNet > CAS > 1210-34-0 Dibenzosuberol
1210-34-0 Dibenzosuberol
produktnavn |
Dibenzosuberol |
Synonymer |
10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ol; dibenzo(b,f)cycloheptan-1-ol; Dibenzo[b,f]-1-cycloheptanol; 10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ol; 10,11-Dihydro-5H-dibenzo[a,d]cyclohetpten-5-ol |
Molekylær Formel |
C15H14O |
Molekylvekt |
210.2711 |
InChI |
InChI=1/C15H14O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2 |
CAS-nummer |
1210-34-0 |
EINECS |
214-911-8 |
Molecular Structure |
|
Tetthet |
1.163g/cm3 |
Smeltepunkt |
90-95℃ |
Kokepunkt |
365.5°C at 760 mmHg |
Brytningsindeks |
1.633 |
Flammepunktet |
135.6°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|