ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
produktnavn |
3-Iodophenylacetonitrile |
Synonymer |
3-Iodobenzyl cyanide |
Molekylær Formel |
C8H6IN |
Molekylvekt |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
CAS-nummer |
130723-54-5 |
Molecular Structure |
|
Tetthet |
1.764g/cm3 |
Kokepunkt |
308.6°C at 760 mmHg |
Brytningsindeks |
1.624 |
Flammepunktet |
140.4°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|