produktnavn |
1,6-Anhydro-beta-D-glucose-2,3,4-tri-O-acetate |
Synonymer |
1,6-anhydro-B-D-glucose 2,3,4-*triacetate; 1,6-Anhydro-2,3,4-tri-O-acetyl--D-glucopyranose; 6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name); (1S,2R,3S,4R,5S)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name); (1R,2R,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name) |
Molekylær Formel |
C12H16O8 |
Molekylvekt |
288.2506 |
InChI |
InChI=1/C12H16O8/c1-5(13)17-9-8-4-16-12(20-8)11(19-7(3)15)10(9)18-6(2)14/h8-12H,4H2,1-3H3/t8-,9-,10+,11-,12-/m1/s1 |
CAS-nummer |
13242-55-2 |
EINECS |
236-222-1 |
Molecular Structure |
|
Tetthet |
1.344g/cm3 |
Smeltepunkt |
111℃ |
Kokepunkt |
392°C at 760 mmHg |
Brytningsindeks |
1.494 |
Flammepunktet |
147.326°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|