ChemNet > CAS > 13979-81-2 3,5-Dibromo-4-methylphenol
13979-81-2 3,5-Dibromo-4-methylphenol
produktnavn |
3,5-Dibromo-4-methylphenol |
Synonymer |
3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
Molekylær Formel |
C7H6Br2O |
Molekylvekt |
265.9299 |
InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
CAS-nummer |
13979-81-2 |
EINECS |
237-763-6 |
Molecular Structure |
|
Tetthet |
1.948g/cm3 |
Kokepunkt |
293.1°C at 760 mmHg |
Brytningsindeks |
1.626 |
Flammepunktet |
131.1°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|