ChemNet > CAS > 1424-66-4 2-chloro-4-(dimethylamino)benzaldehyde
1424-66-4 2-chloro-4-(dimethylamino)benzaldehyde
produktnavn |
2-chloro-4-(dimethylamino)benzaldehyde |
Synonymer |
Benzaldehyde, 2-chloro-4-(dimethylamino)-; 2-Chloro-4-(dimethylamino)benzaldehyde; NSC 93918; 2-Chloro-4-dimethylaminobenzaldehyde |
Molekylær Formel |
C9H10ClNO |
Molekylvekt |
183.6348 |
InChI |
InChI=1/C9H10ClNO/c1-11(2)8-4-3-7(6-12)9(10)5-8/h3-6H,1-2H3 |
CAS-nummer |
1424-66-4 |
EINECS |
215-840-5 |
Molecular Structure |
|
Tetthet |
1.215g/cm3 |
Smeltepunkt |
70℃ |
Kokepunkt |
309.4°C at 760 mmHg |
Brytningsindeks |
1.607 |
Flammepunktet |
140.9°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|