ChemNet > CAS > 14305-08-9 4,5-dibromo-2-phenyl-2,3-dihydropyridazin-3-one
14305-08-9 4,5-dibromo-2-phenyl-2,3-dihydropyridazin-3-one
produktnavn |
4,5-dibromo-2-phenyl-2,3-dihydropyridazin-3-one |
Synonymer |
3(2H)-Pyridazinone, 4,5-dibromo-2-phenyl-; 4,5-Dibromo-2-phenyl-3(2H)-pyridazinone; 4-24-00-00169 (Beilstein Handbook Reference); BRN 0177515; 4,5-dibromo-2-phenylpyridazin-3(2H)-one |
Molekylær Formel |
C10H6Br2N2O |
Molekylvekt |
329.9754 |
InChI |
InChI=1/C10H6Br2N2O/c11-8-6-13-14(10(15)9(8)12)7-4-2-1-3-5-7/h1-6H |
CAS-nummer |
14305-08-9 |
Molecular Structure |
|
Tetthet |
1.89g/cm3 |
Smeltepunkt |
143℃ |
Kokepunkt |
340.1°C at 760 mmHg |
Brytningsindeks |
1.687 |
Flammepunktet |
159.5°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|