ChemNet > CAS > 1475-12-3 1-(2,5-Dichlorophenyl)ethanol
1475-12-3 1-(2,5-Dichlorophenyl)ethanol
produktnavn |
1-(2,5-Dichlorophenyl)ethanol |
Synonymer |
2,5-Dichloro-alpha-methylbenzyl alcohol~2,5-Dichlorophenyl methyl carbinol; 2,5-Dichlorophenyl Ethanol |
Molekylær Formel |
C8H8Cl2O |
Molekylvekt |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3 |
CAS-nummer |
1475-12-3 |
EINECS |
216-018-9 |
Molecular Structure |
|
Tetthet |
1.323g/cm3 |
Kokepunkt |
257.9°C at 760 mmHg |
Brytningsindeks |
1.566 |
Flammepunktet |
112.1°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|