ChemNet > CAS > 1583-59-1 2,2-Difluoro-1,3-benzodioxole
1583-59-1 2,2-Difluoro-1,3-benzodioxole
| produktnavn |
2,2-Difluoro-1,3-benzodioxole |
| Synonymer |
1,2-[(Difluoromethylene)dioxy]benzene; 2,2-difluorobenzo[d][1,3]dioxole; 2,2-Difluorobenzodioxole; 2,2-Difluoro-2H-1,3-benzodioxole |
| Molekylær Formel |
C7H4F2O2 |
| Molekylvekt |
158.1023 |
| InChI |
InChI=1/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
| CAS-nummer |
1583-59-1 |
| EINECS |
216-431-4 |
| Molecular Structure |
|
| Tetthet |
1.42g/cm3 |
| Kokepunkt |
125.1°C at 760 mmHg |
| Brytningsindeks |
1.509 |
| Flammepunktet |
35.1°C |
| Hazard symboler |
|
| Risiko Koder |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
