ChemNet > CAS > 161446-90-8 3-Chloro-4-fluorobenzyl alcohol
161446-90-8 3-Chloro-4-fluorobenzyl alcohol
produktnavn |
3-Chloro-4-fluorobenzyl alcohol |
Synonymer |
(3-chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzyla alcohol |
Molekylær Formel |
C7H6ClFO |
Molekylvekt |
160.5733 |
InChI |
InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
CAS-nummer |
161446-90-8 |
Molecular Structure |
|
Tetthet |
1.344g/cm3 |
Kokepunkt |
242.5°C at 760 mmHg |
Brytningsindeks |
1.542 |
Flammepunktet |
100.4°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|