ChemNet > CAS > 1620-76-4 2-Cyano-4-methylpyridine
1620-76-4 2-Cyano-4-methylpyridine
| produktnavn |
2-Cyano-4-methylpyridine |
| Synonymer |
2-Cyano-4-picoline; 4-Methylpicolinonitrile; 4-Methyl-2-pyridinecarbonitrile; 4-methylpyridine-2-carbonitrile |
| Molekylær Formel |
C7H6N2 |
| Molekylvekt |
118.1359 |
| InChI |
InChI=1/C7H6N2/c1-6-2-3-9-7(4-6)5-8/h2-4H,1H3 |
| CAS-nummer |
1620-76-4 |
| EINECS |
244-131-3 |
| Molecular Structure |
|
| Tetthet |
1.08g/cm3 |
| Kokepunkt |
261.1°C at 760 mmHg |
| Brytningsindeks |
1.531 |
| Flammepunktet |
99.9°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
