ChemNet > CAS > 163517-62-2 5-fluoro-2-methylphenylboronic acid
163517-62-2 5-fluoro-2-methylphenylboronic acid
| produktnavn |
5-fluoro-2-methylphenylboronic acid |
| Synonymer |
5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid; 5-Fluoro-2-methylbenzeneboronic acid |
| Molekylær Formel |
C7H8BFO2 |
| Molekylvekt |
153.9466 |
| InChI |
InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3 |
| CAS-nummer |
163517-62-2 |
| Molecular Structure |
|
| Tetthet |
1.2g/cm3 |
| Kokepunkt |
287.7°C at 760 mmHg |
| Brytningsindeks |
1.505 |
| Flammepunktet |
127.8°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
