ChemNet > CAS > 1638-22-8 p-butylphenol
1638-22-8 p-butylphenol
| produktnavn |
p-butylphenol |
| Synonymer |
4-n-Butylphenol; 4-butylphenol |
| Molekylær Formel |
C10H14O |
| Molekylvekt |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| CAS-nummer |
1638-22-8 |
| EINECS |
216-672-5 |
| Molecular Structure |
|
| Tetthet |
0.977g/cm3 |
| Kokepunkt |
246.2°C at 760 mmHg |
| Brytningsindeks |
1.522 |
| Flammepunktet |
121.5°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
