ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
produktnavn |
5-Nitrothiophene-2-carbonitrile |
Synonymer |
2-Cyano-5-nitrothiophene |
Molekylær Formel |
C5H2N2O2S |
Molekylvekt |
154.1466 |
InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
CAS-nummer |
16689-02-4 |
Molecular Structure |
|
Tetthet |
1.5g/cm3 |
Kokepunkt |
273.9°C at 760 mmHg |
Brytningsindeks |
1.611 |
Flammepunktet |
119.4°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|