ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
| produktnavn |
3-Fluoro-4-methylbenzonitrile |
| Synonymer |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
| Molekylær Formel |
C8H6FN |
| Molekylvekt |
135.1383 |
| InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| CAS-nummer |
170572-49-3 |
| Molecular Structure |
|
| Tetthet |
1.117g/cm3 |
| Smeltepunkt |
48-50℃ |
| Kokepunkt |
215.069°C at 760 mmHg |
| Brytningsindeks |
1.508 |
| Flammepunktet |
90.3°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
