ChemNet > CAS > 17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
produktnavn |
(2R,5R)-(-)-2,5-Hexanediol |
Synonymer |
(2R,5R)-2,5-Hexanediol; Hexanediolcolorlessxtl; (2R,5R)-Dihydroxyhexane; (2R,5R)-hexane-2,5-diol |
Molekylær Formel |
C6H14O2 |
Molekylvekt |
118.1742 |
InChI |
InChI=1/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
CAS-nummer |
17299-07-9 |
Molecular Structure |
|
Tetthet |
0.958g/cm3 |
Smeltepunkt |
50-53℃ |
Kokepunkt |
213.4°C at 760 mmHg |
Brytningsindeks |
1.445 |
Flammepunktet |
101.7°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|