ChemNet > CAS > 17356-19-3 1-Ethynylcyclopentanol
17356-19-3 1-Ethynylcyclopentanol
| produktnavn |
1-Ethynylcyclopentanol |
| Molekylær Formel |
C7H10O |
| Molekylvekt |
110.1537 |
| InChI |
InChI=1/C7H10O/c1-2-7(8)5-3-4-6-7/h1,8H,3-6H2 |
| CAS-nummer |
17356-19-3 |
| EINECS |
241-385-7 |
| Molecular Structure |
|
| Tetthet |
1.01g/cm3 |
| Smeltepunkt |
27-159℃ |
| Kokepunkt |
155.4°C at 760 mmHg |
| Brytningsindeks |
1.497 |
| Flammepunktet |
48.9°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R10:Flammable.;
R22:Harmful if swallowed.;
R36/37:Irritating to eyes and respiratory system.;
|
| Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|
