ChemNet > CAS > 1740-57-4 Isophthalamide
1740-57-4 Isophthalamide
produktnavn |
Isophthalamide |
Synonymer |
1,3-Benzenedicarboxamide; 1-09-00-00372 (Beilstein Handbook Reference); BRN 2045544; Isophthalic acid diamide; m-Carbamoylbenzamide; m-Phthalamide; Isophthaldiamide; benzene-1,3-dicarboxamide |
Molekylær Formel |
C8H8N2O2 |
Molekylvekt |
164.1613 |
InChI |
InChI=1/C8H8N2O2/c9-7(11)5-2-1-3-6(4-5)8(10)12/h1-4H,(H2,9,11)(H2,10,12) |
CAS-nummer |
1740-57-4 |
EINECS |
217-104-9 |
Molecular Structure |
|
Tetthet |
1.294g/cm3 |
Kokepunkt |
430.8°C at 760 mmHg |
Brytningsindeks |
1.612 |
Flammepunktet |
214.4°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|