ChemNet > CAS > 175203-19-7 1-(2-bromo-4,6-difluorophenoxy)-2-chloroethane
175203-19-7 1-(2-bromo-4,6-difluorophenoxy)-2-chloroethane
produktnavn |
1-(2-bromo-4,6-difluorophenoxy)-2-chloroethane |
Synonymer |
1-Bromo-2-(2-chloroethoxy)-3,5-difluorobenzene |
Molekylær Formel |
C8H6BrClF2O |
Molekylvekt |
271.4864 |
InChI |
InChI=1/C8H6BrClF2O/c9-6-3-5(11)4-7(12)8(6)13-2-1-10/h3-4H,1-2H2 |
CAS-nummer |
175203-19-7 |
Molecular Structure |
|
Tetthet |
1.636g/cm3 |
Kokepunkt |
282.9°C at 760 mmHg |
Brytningsindeks |
1.515 |
Flammepunktet |
124.9°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|