ChemNet > CAS > 175204-41-8 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile
175204-41-8 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile
produktnavn |
3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile |
Synonymer |
3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
Molekylær Formel |
C11H8ClFN2OS |
Molekylvekt |
270.7104 |
InChI |
InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
CAS-nummer |
175204-41-8 |
Molecular Structure |
|
Tetthet |
1.426g/cm3 |
Smeltepunkt |
85℃ |
Kokepunkt |
408.4°C at 760 mmHg |
Brytningsindeks |
1.625 |
Flammepunktet |
200.8°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|