ChemNet > CAS > 1753-75-9 5-bromo-2,1,3-benzothiadiazole
1753-75-9 5-bromo-2,1,3-benzothiadiazole
produktnavn |
5-bromo-2,1,3-benzothiadiazole |
Molekylær Formel |
C6H3BrN2S |
Molekylvekt |
215.0704 |
InChI |
InChI=1/C6H3BrN2S/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H |
CAS-nummer |
1753-75-9 |
Molecular Structure |
|
Tetthet |
1.859g/cm3 |
Smeltepunkt |
51℃ |
Kokepunkt |
272.2°C at 760 mmHg |
Brytningsindeks |
1.733 |
Flammepunktet |
118.4°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|