ChemNet > CAS > 18190-44-8 N-(2-Hydroxyethyl)succinimide
18190-44-8 N-(2-Hydroxyethyl)succinimide
| produktnavn |
N-(2-Hydroxyethyl)succinimide |
| Synonymer |
1-(2-hydroxyethyl)pyrrolidine-2,5-dione |
| Molekylær Formel |
C6H9NO3 |
| Molekylvekt |
143.1406 |
| InChI |
InChI=1/C6H9NO3/c8-4-3-7-5(9)1-2-6(7)10/h8H,1-4H2 |
| CAS-nummer |
18190-44-8 |
| Molecular Structure |
|
| Tetthet |
1.327g/cm3 |
| Smeltepunkt |
57-61℃ |
| Kokepunkt |
351.8°C at 760 mmHg |
| Brytningsindeks |
1.526 |
| Flammepunktet |
166.6°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
