ChemNet > CAS > 1823-44-5 2-(2-Thiazolylazo)-p-cresol
1823-44-5 2-(2-Thiazolylazo)-p-cresol
produktnavn |
2-(2-Thiazolylazo)-p-cresol |
Synonymer |
TAC; 4-Methyl-2-(2-thiazolylazo)-phenol; 4-methyl-6-(1,3-thiazol-2-ylhydrazono)cyclohexa-2,4-dien-1-one; (6E)-4-methyl-6-[2-(1,3-thiazol-2-yl)hydrazinylidene]cyclohexa-2,4-dien-1-one |
Molekylær Formel |
C10H9N3OS |
Molekylvekt |
219.263 |
InChI |
InChI=1/C10H9N3OS/c1-7-2-3-9(14)8(6-7)12-13-10-11-4-5-15-10/h2-6H,1H3,(H,11,13)/b12-8+ |
CAS-nummer |
1823-44-5 |
Molecular Structure |
|
Tetthet |
1.357g/cm3 |
Smeltepunkt |
127-130℃ |
Kokepunkt |
464.649°C at 760 mmHg |
Brytningsindeks |
1.681 |
Flammepunktet |
234.812°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|