ChemNet > CAS > 18355-80-1 2,3-difluoroacetophenone
18355-80-1 2,3-difluoroacetophenone
| produktnavn |
2,3-difluoroacetophenone |
| Synonymer |
2',3'-difluoroacetophenone; 1-(2,3-difluorophenyl)ethanone |
| Molekylær Formel |
C8H6F2O |
| Molekylvekt |
156.1294 |
| InChI |
InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| CAS-nummer |
18355-80-1 |
| Molecular Structure |
|
| Tetthet |
1.206g/cm3 |
| Kokepunkt |
193.4°C at 760 mmHg |
| Brytningsindeks |
1.472 |
| Flammepunktet |
71.5°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
