ChemNet > CAS > 19056-40-7 4-Bromo-3-methoxyaniline
19056-40-7 4-Bromo-3-methoxyaniline
produktnavn |
4-Bromo-3-methoxyaniline |
Synonymer |
4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine |
Molekylær Formel |
C13H10N2O4 |
Molekylvekt |
258.2295 |
InChI |
InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
CAS-nummer |
19056-40-7 |
Molecular Structure |
|
Tetthet |
1.381g/cm3 |
Kokepunkt |
467°C at 760 mmHg |
Brytningsindeks |
1.655 |
Flammepunktet |
236.2°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|