ChemNet > CAS > 20029-52-1 Cyclohexybenzoicacid
20029-52-1 Cyclohexybenzoicacid
produktnavn |
Cyclohexybenzoicacid |
Synonymer |
4-Cyclohexylbenzoic acid; 4-cyclohexylbenzoate |
Molekylær Formel |
C13H15O2 |
Molekylvekt |
203.2575 |
InChI |
InChI=1/C13H16O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10H,1-5H2,(H,14,15)/p-1 |
CAS-nummer |
20029-52-1 |
EINECS |
243-472-5 |
Molecular Structure |
|
Kokepunkt |
351.1°C at 760 mmHg |
Flammepunktet |
163.9°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|