ChemNet > CAS > 20256-39-7 2-Acetamido-5-chlorothiazole
20256-39-7 2-Acetamido-5-chlorothiazole
produktnavn |
2-Acetamido-5-chlorothiazole |
Synonymer |
N-(5-chloro-1,3-thiazol-2-yl)acetamide |
Molekylær Formel |
C5H5ClN2OS |
Molekylvekt |
176.624 |
InChI |
InChI=1/C5H5ClN2OS/c1-3(9)8-5-7-2-4(6)10-5/h2H,1H3,(H,7,8,9) |
CAS-nummer |
20256-39-7 |
Molecular Structure |
|
Tetthet |
1.507g/cm3 |
Brytningsindeks |
1.633 |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|